C16H13ClF2N2O3S — CID 112505881
N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3,4-difluorobenzamide (PubChem CID 112505881) has the molecular formula C16H13ClF2N2O3S and a molecular weight of 386.81 g/mol. Its IUPAC name is N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 112505881 |
| Molecular Formula | C16H13ClF2N2O3S |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3,4-difluorobenzamide |
| SMILES | O=C(Nc1cc(N2CCCS2(=O)=O)ccc1Cl)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H13ClF2N2O3S/c17-12-4-3-11(21-6-1-7-25(21,23)24)9-15(12)20-16(22)10-2-5-13(18)14(19)8-10/h2-5,8-9H,1,6-7H2,(H,20,22) |
| InChIKey | OYCXSUWFCRKBIK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |