C17H15ClF2N2O3S — CID 7516982
4-chloro-N-(2,5-difluorophenyl)-3-(1,1-dioxothiazinan-2-yl)benzamide (PubChem CID 7516982) has the molecular formula C17H15ClF2N2O3S and a molecular weight of 400.83 g/mol. Its IUPAC name is 4-chloro-N-(2,5-difluorophenyl)-3-(1,1-dioxothiazinan-2-yl)benzamide.
| Compound Name | 4-chloro-N-(2,5-difluorophenyl)-3-(1,1-dioxothiazinan-2-yl)benzamide |
|---|---|
| PubChem CID | 7516982 |
| Molecular Formula | C17H15ClF2N2O3S |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 4-chloro-N-(2,5-difluorophenyl)-3-(1,1-dioxothiazinan-2-yl)benzamide |
| SMILES | O=C(Nc1cc(F)ccc1F)c1ccc(Cl)c(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C17H15ClF2N2O3S/c18-13-5-3-11(9-16(13)22-7-1-2-8-26(22,24)25)17(23)21-15-10-12(19)4-6-14(15)20/h3-6,9-10H,1-2,7-8H2,(H,21,23) |
| InChIKey | ARNYFVAJIJQGDW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |