C17H27ClN3O3S+ — CID 7686137
2-[[4-chloro-3-(1,1-dioxothiazinan-2-yl)benzoyl]amino]ethyl-diethylazanium (PubChem CID 7686137) has the molecular formula C17H27ClN3O3S+ and a molecular weight of 388.94 g/mol. Its IUPAC name is 2-[[4-chloro-3-(1,1-dioxothiazinan-2-yl)benzoyl]amino]ethyl-diethylazanium.
| Compound Name | 2-[[4-chloro-3-(1,1-dioxothiazinan-2-yl)benzoyl]amino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7686137 |
| Molecular Formula | C17H27ClN3O3S+ |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-[[4-chloro-3-(1,1-dioxothiazinan-2-yl)benzoyl]amino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCNC(=O)c1ccc(Cl)c(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C17H26ClN3O3S/c1-3-20(4-2)11-9-19-17(22)14-7-8-15(18)16(13-14)21-10-5-6-12-25(21,23)24/h7-8,13H,3-6,9-12H2,1-2H3,(H,19,22)/p+1 |
| InChIKey | WIJWRZPNWMUUQZ-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |