C12H15ClN2O4S — CID 110618019
4-chloro-3-(1,1-dioxothiazinan-2-yl)-N-methoxybenzamide (PubChem CID 110618019) has the molecular formula C12H15ClN2O4S and a molecular weight of 318.78 g/mol. Its IUPAC name is 4-chloro-3-(1,1-dioxothiazinan-2-yl)-N-methoxybenzamide.
| Compound Name | 4-chloro-3-(1,1-dioxothiazinan-2-yl)-N-methoxybenzamide |
|---|---|
| PubChem CID | 110618019 |
| Molecular Formula | C12H15ClN2O4S |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 4-chloro-3-(1,1-dioxothiazinan-2-yl)-N-methoxybenzamide |
| SMILES | CONC(=O)c1ccc(Cl)c(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C12H15ClN2O4S/c1-19-14-12(16)9-4-5-10(13)11(8-9)15-6-2-3-7-20(15,17)18/h4-5,8H,2-3,6-7H2,1H3,(H,14,16) |
| InChIKey | UCQWTDBNQRDYEK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|