C20H20ClN3O3S — CID 71704555
4-chloro-3-(1,1-dioxothiazinan-2-yl)-N-(1-methylindol-4-yl)benzamide (PubChem CID 71704555) has the molecular formula C20H20ClN3O3S and a molecular weight of 417.92 g/mol. Its IUPAC name is 4-chloro-3-(1,1-dioxothiazinan-2-yl)-N-(1-methylindol-4-yl)benzamide.
| Compound Name | 4-chloro-3-(1,1-dioxothiazinan-2-yl)-N-(1-methylindol-4-yl)benzamide |
|---|---|
| PubChem CID | 71704555 |
| Molecular Formula | C20H20ClN3O3S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 4-chloro-3-(1,1-dioxothiazinan-2-yl)-N-(1-methylindol-4-yl)benzamide |
| SMILES | Cn1ccc2c(NC(=O)c3ccc(Cl)c(N4CCCCS4(=O)=O)c3)cccc21 |
| InChI | InChI=1S/C20H20ClN3O3S/c1-23-11-9-15-17(5-4-6-18(15)23)22-20(25)14-7-8-16(21)19(13-14)24-10-2-3-12-28(24,26)27/h4-9,11,13H,2-3,10,12H2,1H3,(H,22,25) |
| InChIKey | PPESKOLGKHDYAN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |