C16H14ClFN2O3S — CID 51246208
N-(3-chloro-4-fluorophenyl)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 51246208) has the molecular formula C16H14ClFN2O3S and a molecular weight of 368.82 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 51246208 |
| Molecular Formula | C16H14ClFN2O3S |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C16H14ClFN2O3S/c17-14-10-12(4-7-15(14)18)19-16(21)11-2-5-13(6-3-11)20-8-1-9-24(20,22)23/h2-7,10H,1,8-9H2,(H,19,21) |
| InChIKey | AUYMYTCSYAHKEO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |