C16H14FN3O5S — CID 134059983
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(4-fluoro-3-nitrophenyl)benzamide (PubChem CID 134059983) has the molecular formula C16H14FN3O5S and a molecular weight of 379.37 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(4-fluoro-3-nitrophenyl)benzamide.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(4-fluoro-3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 134059983 |
| Molecular Formula | C16H14FN3O5S |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(4-fluoro-3-nitrophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c([N+](=O)[O-])c1)c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C16H14FN3O5S/c17-14-7-4-12(10-15(14)20(22)23)18-16(21)11-2-5-13(6-3-11)19-8-1-9-26(19,24)25/h2-7,10H,1,8-9H2,(H,18,21) |
| InChIKey | KYOCHQXETBAEET-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|