C14H22N2O6S2 — CID 110623026
N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-(2-methoxyethoxy)ethanesulfonamide (PubChem CID 110623026) has the molecular formula C14H22N2O6S2 and a molecular weight of 378.47 g/mol. Its IUPAC name is N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-(2-methoxyethoxy)ethanesulfonamide.
| Compound Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-(2-methoxyethoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 110623026 |
| Molecular Formula | C14H22N2O6S2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-(2-methoxyethoxy)ethanesulfonamide |
| SMILES | COCCOCCS(=O)(=O)Nc1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C14H22N2O6S2/c1-21-8-9-22-10-12-23(17,18)15-13-3-5-14(6-4-13)16-7-2-11-24(16,19)20/h3-6,15H,2,7-12H2,1H3 |
| InChIKey | DKQQCOZVDHFDPM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|