C15H24N2O6S2 — CID 110633307
2-(2-methoxyethoxy)-N-(3-pyrrolidin-1-ylsulfonylphenyl)ethanesulfonamide (PubChem CID 110633307) has the molecular formula C15H24N2O6S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(3-pyrrolidin-1-ylsulfonylphenyl)ethanesulfonamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(3-pyrrolidin-1-ylsulfonylphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110633307 |
| Molecular Formula | C15H24N2O6S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(3-pyrrolidin-1-ylsulfonylphenyl)ethanesulfonamide |
| SMILES | COCCOCCS(=O)(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C15H24N2O6S2/c1-22-9-10-23-11-12-24(18,19)16-14-5-4-6-15(13-14)25(20,21)17-7-2-3-8-17/h4-6,13,16H,2-3,7-12H2,1H3 |
| InChIKey | VUFMBWWXEWUBPN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|