C19H18N2O5S2 — CID 127038162
2,7-bis(1,1-dioxo-1,2-thiazolidin-2-yl)fluoren-9-one (PubChem CID 127038162) has the molecular formula C19H18N2O5S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2,7-bis(1,1-dioxo-1,2-thiazolidin-2-yl)fluoren-9-one.
| Compound Name | 2,7-bis(1,1-dioxo-1,2-thiazolidin-2-yl)fluoren-9-one |
|---|---|
| PubChem CID | 127038162 |
| Molecular Formula | C19H18N2O5S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2,7-bis(1,1-dioxo-1,2-thiazolidin-2-yl)fluoren-9-one |
| SMILES | O=C1c2cc(N3CCCS3(=O)=O)ccc2-c2ccc(N3CCCS3(=O)=O)cc21 |
| InChI | InChI=1S/C19H18N2O5S2/c22-19-17-11-13(20-7-1-9-27(20,23)24)3-5-15(17)16-6-4-14(12-18(16)19)21-8-2-10-28(21,25)26/h3-6,11-12H,1-2,7-10H2 |
| InChIKey | VGKXSWRQTXUVKU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |