C11H14BrNO2S — CID 82094857
2-(2-bromo-4-methylphenyl)thiazinane 1,1-dioxide (PubChem CID 82094857) has the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenyl)thiazinane 1,1-dioxide.
| Compound Name | 2-(2-bromo-4-methylphenyl)thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 82094857 |
| Molecular Formula | C11H14BrNO2S |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 2-(2-bromo-4-methylphenyl)thiazinane 1,1-dioxide |
| SMILES | Cc1ccc(N2CCCCS2(=O)=O)c(Br)c1 |
| InChI | InChI=1S/C11H14BrNO2S/c1-9-4-5-11(10(12)8-9)13-6-2-3-7-16(13,14)15/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | IYFPDPLAXNIIGA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |