C11H11BrF3NO2S — CID 114043039
2-[2-bromo-5-(trifluoromethyl)phenyl]thiazinane 1,1-dioxide (PubChem CID 114043039) has the molecular formula C11H11BrF3NO2S and a molecular weight of 358.18 g/mol. Its IUPAC name is 2-[2-bromo-5-(trifluoromethyl)phenyl]thiazinane 1,1-dioxide.
| Compound Name | 2-[2-bromo-5-(trifluoromethyl)phenyl]thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 114043039 |
| Molecular Formula | C11H11BrF3NO2S |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 2-[2-bromo-5-(trifluoromethyl)phenyl]thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCN1c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C11H11BrF3NO2S/c12-9-4-3-8(11(13,14)15)7-10(9)16-5-1-2-6-19(16,17)18/h3-4,7H,1-2,5-6H2 |
| InChIKey | XWQCUYBAEATTKG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |