C10H9BrN2O2S — CID 107796158
3-bromo-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzonitrile (PubChem CID 107796158) has the molecular formula C10H9BrN2O2S and a molecular weight of 301.17 g/mol. Its IUPAC name is 3-bromo-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzonitrile.
| Compound Name | 3-bromo-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 107796158 |
| Molecular Formula | C10H9BrN2O2S |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 3-bromo-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCCS2(=O)=O)c(Br)c1 |
| InChI | InChI=1S/C10H9BrN2O2S/c11-9-6-8(7-12)2-3-10(9)13-4-1-5-16(13,14)15/h2-3,6H,1,4-5H2 |
| InChIKey | JKJHYCRFYVBZRM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |