C12H15N3O2S — CID 117015258
4-(1,1-dioxo-1,2,5-thiadiazocan-2-yl)benzonitrile (PubChem CID 117015258) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2,5-thiadiazocan-2-yl)benzonitrile.
| Compound Name | 4-(1,1-dioxo-1,2,5-thiadiazocan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 117015258 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-(1,1-dioxo-1,2,5-thiadiazocan-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCNCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C12H15N3O2S/c13-10-11-2-4-12(5-3-11)15-8-7-14-6-1-9-18(15,16)17/h2-5,14H,1,6-9H2 |
| InChIKey | JQVUYXDFPTZQSD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |