C14H17N3O — CID 117015060
4-(3-methyl-2-oxo-1,5-diazocan-1-yl)benzonitrile (PubChem CID 117015060) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-(3-methyl-2-oxo-1,5-diazocan-1-yl)benzonitrile.
| Compound Name | 4-(3-methyl-2-oxo-1,5-diazocan-1-yl)benzonitrile |
|---|---|
| PubChem CID | 117015060 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-(3-methyl-2-oxo-1,5-diazocan-1-yl)benzonitrile |
| SMILES | CC1CNCCCN(c2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C14H17N3O/c1-11-10-16-7-2-8-17(14(11)18)13-5-3-12(9-15)4-6-13/h3-6,11,16H,2,7-8,10H2,1H3 |
| InChIKey | RVLVIRIPUUNCFW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |