C16H23N3O6S — CID 75269759
N'-[4-(1,1-dioxothiazinan-2-yl)-3-methoxyphenyl]-N-(2-hydroxypropyl)oxamide (PubChem CID 75269759) has the molecular formula C16H23N3O6S and a molecular weight of 385.44 g/mol. Its IUPAC name is N'-[4-(1,1-dioxothiazinan-2-yl)-3-methoxyphenyl]-N-(2-hydroxypropyl)oxamide.
| Compound Name | N'-[4-(1,1-dioxothiazinan-2-yl)-3-methoxyphenyl]-N-(2-hydroxypropyl)oxamide |
|---|---|
| PubChem CID | 75269759 |
| Molecular Formula | C16H23N3O6S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N'-[4-(1,1-dioxothiazinan-2-yl)-3-methoxyphenyl]-N-(2-hydroxypropyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NCC(C)O)ccc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C16H23N3O6S/c1-11(20)10-17-15(21)16(22)18-12-5-6-13(14(9-12)25-2)19-7-3-4-8-26(19,23)24/h5-6,9,11,20H,3-4,7-8,10H2,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | JYRPIMXLCQPRRN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|