C22H27N3O6S — CID 124652070
N-[3-(1,1-dioxothiazinan-2-yl)-4-methoxyphenyl]-N'-[(2R)-1-hydroxy-3-phenylpropan-2-yl]oxamide (PubChem CID 124652070) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiazinan-2-yl)-4-methoxyphenyl]-N'-[(2R)-1-hydroxy-3-phenylpropan-2-yl]oxamide.
| Compound Name | N-[3-(1,1-dioxothiazinan-2-yl)-4-methoxyphenyl]-N'-[(2R)-1-hydroxy-3-phenylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 124652070 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | N-[3-(1,1-dioxothiazinan-2-yl)-4-methoxyphenyl]-N'-[(2R)-1-hydroxy-3-phenylpropan-2-yl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)N[C@@H](CO)Cc2ccccc2)cc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C22H27N3O6S/c1-31-20-10-9-17(14-19(20)25-11-5-6-12-32(25,29)30)23-21(27)22(28)24-18(15-26)13-16-7-3-2-4-8-16/h2-4,7-10,14,18,26H,5-6,11-13,15H2,1H3,(H,23,27)(H,24,28)/t18-/m1/s1 |
| InChIKey | IHFXCRJCAUNOOF-GOSISDBHSA-N |
| XLogP | 1.28 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|