C18H23N3O4 — CID 51049026
2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-2-oxoacetamide (PubChem CID 51049026) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-2-oxoacetamide.
| Compound Name | 2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 51049026 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-2-oxoacetamide |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=O)C(=O)Nc2ccc3c(c2)N(C)C(=O)CO3)C1 |
| InChI | InChI=1S/C18H23N3O4/c1-11-6-12(2)9-21(8-11)18(24)17(23)19-13-4-5-15-14(7-13)20(3)16(22)10-25-15/h4-5,7,11-12H,6,8-10H2,1-3H3,(H,19,23)/t11-,12+ |
| InChIKey | OLCCSSLKWILGQZ-TXEJJXNPSA-N |
| XLogP | 1.48 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|