About N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide
N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide (PubChem CID 51971211) has the molecular formula C21H23N3O4
and a molecular weight of 381.43 g/mol. Its IUPAC name is N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide.
Molecular Properties
| Compound Name | N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide |
| PubChem CID | 51971211 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)C(=O)Nc1ccc2c(c1)N(C)C(=O)CO2 |
| InChI | InChI=1S/C21H23N3O4/c1-14(8-9-15-6-4-3-5-7-15)22-20(26)21(27)23-16-10-11-18-17(12-16)24(2)19(25)13-28-18/h3-7,10-12,14H,8-9,13H2,1-2H3,(H,22,26)(H,23,27)/t14-/m0/s1 |
| InChIKey | CLVCEXZWIJXBNO-AWEZNQCLSA-N |
| XLogP | 2.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide?
The IUPAC name of N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide (CID 51971211) is N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide.
What is the SMILES notation for N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide?
The canonical SMILES for N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide is C[C@@H](CCc1ccccc1)NC(=O)C(=O)Nc1ccc2c(c1)N(C)C(=O)CO2.
What is the InChIKey of N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide?
The InChIKey is CLVCEXZWIJXBNO-AWEZNQCLSA-N. The full InChI is InChI=1S/C21H23N3O4/c1-14(8-9-15-6-4-3-5-7-15)22-20(26)21(27)23-16-10-11-18-17(12-16)24(2)19(25)13-28-18/h3-7,10-12,14H,8-9,13H2,1-2H3,(H,22,26)(H,23,27)/t14-/m0/s1.
What are the key properties of N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide?
N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide has a molecular weight of 381.43 g/mol, XLogP of 2.12, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-N'-[(2S)-4-phenylbutan-2-yl]oxamide is sourced from PubChem (CID 51971211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).