C17H21F3N2O3S — CID 71809353
3-cyclohexylsulfonyl-N-[4-(trifluoromethyl)phenyl]azetidine-1-carboxamide (PubChem CID 71809353) has the molecular formula C17H21F3N2O3S and a molecular weight of 390.43 g/mol. Its IUPAC name is 3-cyclohexylsulfonyl-N-[4-(trifluoromethyl)phenyl]azetidine-1-carboxamide.
| Compound Name | 3-cyclohexylsulfonyl-N-[4-(trifluoromethyl)phenyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 71809353 |
| Molecular Formula | C17H21F3N2O3S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-cyclohexylsulfonyl-N-[4-(trifluoromethyl)phenyl]azetidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N1CC(S(=O)(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C17H21F3N2O3S/c18-17(19,20)12-6-8-13(9-7-12)21-16(23)22-10-15(11-22)26(24,25)14-4-2-1-3-5-14/h6-9,14-15H,1-5,10-11H2,(H,21,23) |
| InChIKey | FYTDUQFUEXDXFP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |