C19H27F3N4O — CID 11581776
4-[(1-methylpiperidin-3-yl)methyl]-N-[4-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 11581776) has the molecular formula C19H27F3N4O and a molecular weight of 384.45 g/mol. Its IUPAC name is 4-[(1-methylpiperidin-3-yl)methyl]-N-[4-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[(1-methylpiperidin-3-yl)methyl]-N-[4-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 11581776 |
| Molecular Formula | C19H27F3N4O |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 4-[(1-methylpiperidin-3-yl)methyl]-N-[4-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | CN1CCCC(CN2CCN(C(=O)Nc3ccc(C(F)(F)F)cc3)CC2)C1 |
| InChI | InChI=1S/C19H27F3N4O/c1-24-8-2-3-15(13-24)14-25-9-11-26(12-10-25)18(27)23-17-6-4-16(5-7-17)19(20,21)22/h4-7,15H,2-3,8-14H2,1H3,(H,23,27) |
| InChIKey | PMADLVVKGUWXFY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |