C17H26FN5O — CID 97279001
N-(6-fluoro-3-pyridinyl)-4-[[(3R)-1-methylpiperidin-3-yl]methyl]piperazine-1-carboxamide (PubChem CID 97279001) has the molecular formula C17H26FN5O and a molecular weight of 335.43 g/mol. Its IUPAC name is N-(6-fluoro-3-pyridinyl)-4-[[(3R)-1-methylpiperidin-3-yl]methyl]piperazine-1-carboxamide.
| Compound Name | N-(6-fluoro-3-pyridinyl)-4-[[(3R)-1-methylpiperidin-3-yl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 97279001 |
| Molecular Formula | C17H26FN5O |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | N-(6-fluoro-3-pyridinyl)-4-[[(3R)-1-methylpiperidin-3-yl]methyl]piperazine-1-carboxamide |
| SMILES | CN1CCC[C@@H](CN2CCN(C(=O)Nc3ccc(F)nc3)CC2)C1 |
| InChI | InChI=1S/C17H26FN5O/c1-21-6-2-3-14(12-21)13-22-7-9-23(10-8-22)17(24)20-15-4-5-16(18)19-11-15/h4-5,11,14H,2-3,6-10,12-13H2,1H3,(H,20,24)/t14-/m1/s1 |
| InChIKey | QIZRFKFMWROSOF-CQSZACIVSA-N |
| XLogP | 1.71 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|