C18H20N4O3 — CID 122256998
4-[1-(phenylcarbamoyl)piperidin-3-yl]oxypyridine-2-carboxamide (PubChem CID 122256998) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-[1-(phenylcarbamoyl)piperidin-3-yl]oxypyridine-2-carboxamide.
| Compound Name | 4-[1-(phenylcarbamoyl)piperidin-3-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 122256998 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 4-[1-(phenylcarbamoyl)piperidin-3-yl]oxypyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(OC2CCCN(C(=O)Nc3ccccc3)C2)ccn1 |
| InChI | InChI=1S/C18H20N4O3/c19-17(23)16-11-14(8-9-20-16)25-15-7-4-10-22(12-15)18(24)21-13-5-2-1-3-6-13/h1-3,5-6,8-9,11,15H,4,7,10,12H2,(H2,19,23)(H,21,24) |
| InChIKey | ONUKGRMGVJHIPL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |