C20H21N3O5 — CID 122256644
methyl 4-[3-[(2-carbamoyl-4-pyridinyl)oxy]piperidine-1-carbonyl]benzoate (PubChem CID 122256644) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is methyl 4-[3-[(2-carbamoyl-4-pyridinyl)oxy]piperidine-1-carbonyl]benzoate.
| Compound Name | methyl 4-[3-[(2-carbamoyl-4-pyridinyl)oxy]piperidine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 122256644 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | methyl 4-[3-[(2-carbamoyl-4-pyridinyl)oxy]piperidine-1-carbonyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCCC(Oc3ccnc(C(N)=O)c3)C2)cc1 |
| InChI | InChI=1S/C20H21N3O5/c1-27-20(26)14-6-4-13(5-7-14)19(25)23-10-2-3-16(12-23)28-15-8-9-22-17(11-15)18(21)24/h4-9,11,16H,2-3,10,12H2,1H3,(H2,21,24) |
| InChIKey | BTHDQYGHWCERBN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |