C17H24N4O3 — CID 122257046
4-[1-(cyclopentylcarbamoyl)piperidin-3-yl]oxypyridine-2-carboxamide (PubChem CID 122257046) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-[1-(cyclopentylcarbamoyl)piperidin-3-yl]oxypyridine-2-carboxamide.
| Compound Name | 4-[1-(cyclopentylcarbamoyl)piperidin-3-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 122257046 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 4-[1-(cyclopentylcarbamoyl)piperidin-3-yl]oxypyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(OC2CCCN(C(=O)NC3CCCC3)C2)ccn1 |
| InChI | InChI=1S/C17H24N4O3/c18-16(22)15-10-13(7-8-19-15)24-14-6-3-9-21(11-14)17(23)20-12-4-1-2-5-12/h7-8,10,12,14H,1-6,9,11H2,(H2,18,22)(H,20,23) |
| InChIKey | XOMCPPXHZVSWER-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |