C20H20N4O3 — CID 122256871
4-[1-(1H-indole-5-carbonyl)piperidin-3-yl]oxypyridine-2-carboxamide (PubChem CID 122256871) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 4-[1-(1H-indole-5-carbonyl)piperidin-3-yl]oxypyridine-2-carboxamide.
| Compound Name | 4-[1-(1H-indole-5-carbonyl)piperidin-3-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 122256871 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-[1-(1H-indole-5-carbonyl)piperidin-3-yl]oxypyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(OC2CCCN(C(=O)c3ccc4[nH]ccc4c3)C2)ccn1 |
| InChI | InChI=1S/C20H20N4O3/c21-19(25)18-11-15(6-8-23-18)27-16-2-1-9-24(12-16)20(26)14-3-4-17-13(10-14)5-7-22-17/h3-8,10-11,16,22H,1-2,9,12H2,(H2,21,25) |
| InChIKey | GOYZPGYWLJLJQH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |