C10H20N2O2S3 — CID 7945367
1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 7945367) has the molecular formula C10H20N2O2S3 and a molecular weight of 296.48 g/mol. Its IUPAC name is 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 7945367 |
| Molecular Formula | C10H20N2O2S3 |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | CSCCCNC(=S)N[C@@]1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H20N2O2S3/c1-10(4-7-17(13,14)8-10)12-9(15)11-5-3-6-16-2/h3-8H2,1-2H3,(H2,11,12,15)/t10-/m0/s1 |
| InChIKey | HTRVESFPULOYEJ-JTQLQIEISA-N |
| XLogP | 0.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|