C13H21N3O3S — CID 63669829
2-methoxy-4-N-(1-methylsulfonylpiperidin-4-yl)benzene-1,4-diamine (PubChem CID 63669829) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-methoxy-4-N-(1-methylsulfonylpiperidin-4-yl)benzene-1,4-diamine.
| Compound Name | 2-methoxy-4-N-(1-methylsulfonylpiperidin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 63669829 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-methoxy-4-N-(1-methylsulfonylpiperidin-4-yl)benzene-1,4-diamine |
| SMILES | COc1cc(NC2CCN(S(C)(=O)=O)CC2)ccc1N |
| InChI | InChI=1S/C13H21N3O3S/c1-19-13-9-11(3-4-12(13)14)15-10-5-7-16(8-6-10)20(2,17)18/h3-4,9-10,15H,5-8,14H2,1-2H3 |
| InChIKey | AAFHPCNGVXPABK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|