C13H16N2O4 — CID 106658517
5-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]-3H-1,3-benzoxazol-2-one (PubChem CID 106658517) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 5-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 106658517 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 5-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]-3H-1,3-benzoxazol-2-one |
| SMILES | CC1(C)OCC(Nc2ccc3oc(=O)[nH]c3c2)CO1 |
| InChI | InChI=1S/C13H16N2O4/c1-13(2)17-6-9(7-18-13)14-8-3-4-11-10(5-8)15-12(16)19-11/h3-5,9,14H,6-7H2,1-2H3,(H,15,16) |
| InChIKey | ATWUVRXZXZIUTM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |