C11H13F2N — CID 104860122
3,4-difluoro-N-(3-methylcyclobutyl)aniline (PubChem CID 104860122) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is 3,4-difluoro-N-(3-methylcyclobutyl)aniline.
| Compound Name | 3,4-difluoro-N-(3-methylcyclobutyl)aniline |
|---|---|
| PubChem CID | 104860122 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 3,4-difluoro-N-(3-methylcyclobutyl)aniline |
| SMILES | CC1CC(Nc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C11H13F2N/c1-7-4-9(5-7)14-8-2-3-10(12)11(13)6-8/h2-3,6-7,9,14H,4-5H2,1H3 |
| InChIKey | CHAQQHSIIKEEAW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |