C14H12BrN3 — CID 115487739
5-(4-bromo-2,6-dimethylanilino)pyridine-2-carbonitrile (PubChem CID 115487739) has the molecular formula C14H12BrN3 and a molecular weight of 302.18 g/mol. Its IUPAC name is 5-(4-bromo-2,6-dimethylanilino)pyridine-2-carbonitrile.
| Compound Name | 5-(4-bromo-2,6-dimethylanilino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 115487739 |
| Molecular Formula | C14H12BrN3 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 5-(4-bromo-2,6-dimethylanilino)pyridine-2-carbonitrile |
| SMILES | Cc1cc(Br)cc(C)c1Nc1ccc(C#N)nc1 |
| InChI | InChI=1S/C14H12BrN3/c1-9-5-11(15)6-10(2)14(9)18-13-4-3-12(7-16)17-8-13/h3-6,8,18H,1-2H3 |
| InChIKey | YRWWELFJLRSARY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |