C10H13F3N2OS — CID 114187380
2-methoxy-4-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,4-diamine (PubChem CID 114187380) has the molecular formula C10H13F3N2OS and a molecular weight of 266.29 g/mol. Its IUPAC name is 2-methoxy-4-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,4-diamine.
| Compound Name | 2-methoxy-4-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 114187380 |
| Molecular Formula | C10H13F3N2OS |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-methoxy-4-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,4-diamine |
| SMILES | COc1cc(NCCSC(F)(F)F)ccc1N |
| InChI | InChI=1S/C10H13F3N2OS/c1-16-9-6-7(2-3-8(9)14)15-4-5-17-10(11,12)13/h2-3,6,15H,4-5,14H2,1H3 |
| InChIKey | WRCMSOSSDRHZMV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|