C14H24N2OS — CID 114124775
2-methoxy-4-N-(6-methylsulfanylhexyl)benzene-1,4-diamine (PubChem CID 114124775) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 2-methoxy-4-N-(6-methylsulfanylhexyl)benzene-1,4-diamine.
| Compound Name | 2-methoxy-4-N-(6-methylsulfanylhexyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 114124775 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-methoxy-4-N-(6-methylsulfanylhexyl)benzene-1,4-diamine |
| SMILES | COc1cc(NCCCCCCSC)ccc1N |
| InChI | InChI=1S/C14H24N2OS/c1-17-14-11-12(7-8-13(14)15)16-9-5-3-4-6-10-18-2/h7-8,11,16H,3-6,9-10,15H2,1-2H3 |
| InChIKey | AAADWEFUYIWYMD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|