C11H10N4O — CID 106398876
3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzonitrile (PubChem CID 106398876) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzonitrile.
| Compound Name | 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 106398876 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzonitrile |
| SMILES | N#Cc1cccc(NCCc2ncno2)c1 |
| InChI | InChI=1S/C11H10N4O/c12-7-9-2-1-3-10(6-9)13-5-4-11-14-8-15-16-11/h1-3,6,8,13H,4-5H2 |
| InChIKey | YVZNCGDVXPBFTA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |