C11H10FN3O3 — CID 114185307
2-fluoro-4-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzoic acid (PubChem CID 114185307) has the molecular formula C11H10FN3O3 and a molecular weight of 251.22 g/mol. Its IUPAC name is 2-fluoro-4-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzoic acid.
| Compound Name | 2-fluoro-4-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 114185307 |
| Molecular Formula | C11H10FN3O3 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-fluoro-4-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCCc2ncno2)cc1F |
| InChI | InChI=1S/C11H10FN3O3/c12-9-5-7(1-2-8(9)11(16)17)13-4-3-10-14-6-15-18-10/h1-2,5-6,13H,3-4H2,(H,16,17) |
| InChIKey | DYOQULNVCLVDFE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |