C11H9FN4O5 — CID 106400871
2-fluoro-5-nitro-4-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzoic acid (PubChem CID 106400871) has the molecular formula C11H9FN4O5 and a molecular weight of 296.21 g/mol. Its IUPAC name is 2-fluoro-5-nitro-4-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzoic acid.
| Compound Name | 2-fluoro-5-nitro-4-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 106400871 |
| Molecular Formula | C11H9FN4O5 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-fluoro-5-nitro-4-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])c(NCCc2ncno2)cc1F |
| InChI | InChI=1S/C11H9FN4O5/c12-7-4-8(13-2-1-10-14-5-15-21-10)9(16(19)20)3-6(7)11(17)18/h3-5,13H,1-2H2,(H,17,18) |
| InChIKey | BGISORNYWSSLMD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|