C11H9N5O3 — CID 104858349
4-nitro-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzonitrile (PubChem CID 104858349) has the molecular formula C11H9N5O3 and a molecular weight of 259.23 g/mol. Its IUPAC name is 4-nitro-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzonitrile.
| Compound Name | 4-nitro-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 104858349 |
| Molecular Formula | C11H9N5O3 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-nitro-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzonitrile |
| SMILES | N#Cc1ccc([N+](=O)[O-])c(NCCc2ncno2)c1 |
| InChI | InChI=1S/C11H9N5O3/c12-6-8-1-2-10(16(17)18)9(5-8)13-4-3-11-14-7-15-19-11/h1-2,5,7,13H,3-4H2 |
| InChIKey | UIPWYZZOOSPEIK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|