C11H9F3N4O3 — CID 103744326
4-nitro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-3-(trifluoromethyl)aniline (PubChem CID 103744326) has the molecular formula C11H9F3N4O3 and a molecular weight of 302.21 g/mol. Its IUPAC name is 4-nitro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-nitro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 103744326 |
| Molecular Formula | C11H9F3N4O3 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-nitro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-3-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(NCCc2ncno2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H9F3N4O3/c12-11(13,14)8-5-7(1-2-9(8)18(19)20)15-4-3-10-16-6-17-21-10/h1-2,5-6,15H,3-4H2 |
| InChIKey | VTYZRCZOIAWQOU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|