C11H10F3N5O3 — CID 154749958
3-[2-[4-nitro-3-(trifluoromethyl)anilino]ethyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 154749958) has the molecular formula C11H10F3N5O3 and a molecular weight of 317.23 g/mol. Its IUPAC name is 3-[2-[4-nitro-3-(trifluoromethyl)anilino]ethyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[2-[4-nitro-3-(trifluoromethyl)anilino]ethyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 154749958 |
| Molecular Formula | C11H10F3N5O3 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 3-[2-[4-nitro-3-(trifluoromethyl)anilino]ethyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(CCNc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)[nH]1 |
| InChI | InChI=1S/C11H10F3N5O3/c12-11(13,14)7-5-6(1-2-8(7)19(21)22)15-4-3-9-16-10(20)18-17-9/h1-2,5,15H,3-4H2,(H2,16,17,18,20) |
| InChIKey | KSBXCPXKIZUXNY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|