C12H16BrFN2O — CID 104925033
5-bromo-N-(2,2-dimethyloxan-4-yl)-3-fluoropyridin-2-amine (PubChem CID 104925033) has the molecular formula C12H16BrFN2O and a molecular weight of 303.18 g/mol. Its IUPAC name is 5-bromo-N-(2,2-dimethyloxan-4-yl)-3-fluoropyridin-2-amine.
| Compound Name | 5-bromo-N-(2,2-dimethyloxan-4-yl)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 104925033 |
| Molecular Formula | C12H16BrFN2O |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 5-bromo-N-(2,2-dimethyloxan-4-yl)-3-fluoropyridin-2-amine |
| SMILES | CC1(C)CC(Nc2ncc(Br)cc2F)CCO1 |
| InChI | InChI=1S/C12H16BrFN2O/c1-12(2)6-9(3-4-17-12)16-11-10(14)5-8(13)7-15-11/h5,7,9H,3-4,6H2,1-2H3,(H,15,16) |
| InChIKey | LEAOACUDWHIPSB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |