C12H15F3N2O — CID 114072659
N-(2,2-dimethyloxan-4-yl)-3,5,6-trifluoropyridin-2-amine (PubChem CID 114072659) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-3,5,6-trifluoropyridin-2-amine.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-3,5,6-trifluoropyridin-2-amine |
|---|---|
| PubChem CID | 114072659 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-3,5,6-trifluoropyridin-2-amine |
| SMILES | CC1(C)CC(Nc2nc(F)c(F)cc2F)CCO1 |
| InChI | InChI=1S/C12H15F3N2O/c1-12(2)6-7(3-4-18-12)16-11-9(14)5-8(13)10(15)17-11/h5,7H,3-4,6H2,1-2H3,(H,16,17) |
| InChIKey | PDYVDTITHCZRAW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|