About N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine
N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine (PubChem CID 136512883) has the molecular formula C16H22N6
and a molecular weight of 298.39 g/mol. Its IUPAC name is N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine |
| PubChem CID | 136512883 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine |
| SMILES | Cc1cc(N2CCC(Nc3ccnc(C)n3)CC2)nc(C)n1 |
| InChI | InChI=1S/C16H22N6/c1-11-10-16(20-13(3)18-11)22-8-5-14(6-9-22)21-15-4-7-17-12(2)19-15/h4,7,10,14H,5-6,8-9H2,1-3H3,(H,17,19,21) |
| InChIKey | YSQWDINEEUGKHG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine?
The IUPAC name of N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine (CID 136512883) is N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine.
What is the SMILES notation for N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine?
The canonical SMILES for N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine is Cc1cc(N2CCC(Nc3ccnc(C)n3)CC2)nc(C)n1.
What is the InChIKey of N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine?
The InChIKey is YSQWDINEEUGKHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N6/c1-11-10-16(20-13(3)18-11)22-8-5-14(6-9-22)21-15-4-7-17-12(2)19-15/h4,7,10,14H,5-6,8-9H2,1-3H3,(H,17,19,21).
What are the key properties of N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine?
N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine has a molecular weight of 298.39 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-2-methylpyrimidin-4-amine is sourced from PubChem (CID 136512883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).