C9H13N3 — CID 62784547
N-cyclobutyl-2-methylpyrimidin-4-amine (PubChem CID 62784547) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is N-cyclobutyl-2-methylpyrimidin-4-amine.
| Compound Name | N-cyclobutyl-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 62784547 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | N-cyclobutyl-2-methylpyrimidin-4-amine |
| SMILES | Cc1nccc(NC2CCC2)n1 |
| InChI | InChI=1S/C9H13N3/c1-7-10-6-5-9(11-7)12-8-3-2-4-8/h5-6,8H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | WBIPDPTZHSWDJX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |