C25H31B3F6N6O5 — CID 169428335
CID 169428335 (PubChem CID 169428335) has the molecular formula C25H31B3F6N6O5 and a molecular weight of 641.98 g/mol.
| Compound Name | CID 169428335 |
|---|---|
| PubChem CID | 169428335 |
| Molecular Formula | C25H31B3F6N6O5 |
| Molecular Weight | 641.98 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | — |
| SMILES | CB(O)N1CCC(Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1.O=[N+]([O-])c1cc(C(F)(F)F)ccc1NC1CCNCC1.[B][B] |
| InChI | InChI=1S/C13H17BF3N3O3.C12H14F3N3O2.B2/c1-14(21)19-6-4-10(5-7-19)18-11-3-2-9(13(15,16)17)8-12(11)20(22)23;13-12(14,15)8-1-2-10(11(7-8)18(19)20)17-9-3-5-16-6-4-9;1-2/h2-3,8,10,18,21H,4-7H2,1H3;1-2,7,9,16-17H,3-6H2; |
| InChIKey | IVMULEAIPFEARX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 145.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.98 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|