C18H32B2ClN5O4 — CID 160654676
(4-aminopiperidin-1-yl)-methylborinic acid;[4-(4-chloro-2-nitroanilino)piperidin-1-yl]-methylborinic acid (PubChem CID 160654676) has the molecular formula C18H32B2ClN5O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-methylborinic acid;[4-(4-chloro-2-nitroanilino)piperidin-1-yl]-methylborinic acid.
| Compound Name | (4-aminopiperidin-1-yl)-methylborinic acid;[4-(4-chloro-2-nitroanilino)piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 160654676 |
| Molecular Formula | C18H32B2ClN5O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (4-aminopiperidin-1-yl)-methylborinic acid;[4-(4-chloro-2-nitroanilino)piperidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCC(N)CC1.CB(O)N1CCC(Nc2ccc(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H17BClN3O3.C6H15BN2O/c1-13(18)16-6-4-10(5-7-16)15-11-3-2-9(14)8-12(11)17(19)20;1-7(10)9-4-2-6(8)3-5-9/h2-3,8,10,15,18H,4-7H2,1H3;6,10H,2-5,8H2,1H3 |
| InChIKey | RKWSZAUJTHAORG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|