C9H10ClN3O4S — CID 125493217
(4S)-N-(4-chloro-2-nitrophenyl)-1,1-dioxo-1,2-thiazolidin-4-amine (PubChem CID 125493217) has the molecular formula C9H10ClN3O4S and a molecular weight of 291.72 g/mol. Its IUPAC name is (4S)-N-(4-chloro-2-nitrophenyl)-1,1-dioxo-1,2-thiazolidin-4-amine.
| Compound Name | (4S)-N-(4-chloro-2-nitrophenyl)-1,1-dioxo-1,2-thiazolidin-4-amine |
|---|---|
| PubChem CID | 125493217 |
| Molecular Formula | C9H10ClN3O4S |
| Molecular Weight | 291.72 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | (4S)-N-(4-chloro-2-nitrophenyl)-1,1-dioxo-1,2-thiazolidin-4-amine |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1N[C@H]1CNS(=O)(=O)C1 |
| InChI | InChI=1S/C9H10ClN3O4S/c10-6-1-2-8(9(3-6)13(14)15)12-7-4-11-18(16,17)5-7/h1-3,7,11-12H,4-5H2/t7-/m0/s1 |
| InChIKey | CRCBPDQZJFNGSB-ZETCQYMHSA-N |
| XLogP | 0.96 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.72 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|