C12H15ClN2O6 — CID 7209508
(2R,3S,4S,5S,6S)-2-(4-chloro-2-nitroanilino)-6-methyloxane-3,4,5-triol (PubChem CID 7209508) has the molecular formula C12H15ClN2O6 and a molecular weight of 318.71 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-(4-chloro-2-nitroanilino)-6-methyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6S)-2-(4-chloro-2-nitroanilino)-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 7209508 |
| Molecular Formula | C12H15ClN2O6 |
| Molecular Weight | 318.71 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-(4-chloro-2-nitroanilino)-6-methyloxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](Nc2ccc(Cl)cc2[N+](=O)[O-])[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H15ClN2O6/c1-5-9(16)10(17)11(18)12(21-5)14-7-3-2-6(13)4-8(7)15(19)20/h2-5,9-12,14,16-18H,1H3/t5-,9+,10-,11-,12+/m0/s1 |
| InChIKey | MZGWUMLEARWVSJ-VVBYJNJRSA-N |
| XLogP | 0.49 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.71 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|