C13H15N2O8- — CID 7124211
2-nitro-4-[[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]benzoate (PubChem CID 7124211) has the molecular formula C13H15N2O8- and a molecular weight of 327.27 g/mol. Its IUPAC name is 2-nitro-4-[[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]benzoate.
| Compound Name | 2-nitro-4-[[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 7124211 |
| Molecular Formula | C13H15N2O8- |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-nitro-4-[[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]benzoate |
| SMILES | C[C@@H]1O[C@@H](Nc2ccc(C(=O)[O-])c([N+](=O)[O-])c2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H16N2O8/c1-5-9(16)10(17)11(18)12(23-5)14-6-2-3-7(13(19)20)8(4-6)15(21)22/h2-5,9-12,14,16-18H,1H3,(H,19,20)/p-1/t5-,9+,10-,11-,12+/m0/s1 |
| InChIKey | TVDZYIHYFGVFAA-VVBYJNJRSA-M |
| XLogP | -1.80 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|