C13H16NO6- — CID 7069213
4-[[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]benzoate (PubChem CID 7069213) has the molecular formula C13H16NO6- and a molecular weight of 282.27 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]benzoate.
| Compound Name | 4-[[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 7069213 |
| Molecular Formula | C13H16NO6- |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-[[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]benzoate |
| SMILES | C[C@@H]1O[C@@H](Nc2ccc(C(=O)[O-])cc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H17NO6/c1-6-9(15)10(16)11(17)12(20-6)14-8-4-2-7(3-5-8)13(18)19/h2-6,9-12,14-17H,1H3,(H,18,19)/p-1/t6-,9+,10-,11-,12+/m0/s1 |
| InChIKey | WOQRPBXJCRJRBC-KHIDNNIESA-M |
| XLogP | -1.71 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |