C26H44N6O8S — CID 67227168
tert-butyl 4-aminopiperidine-1-carboxylate;tert-butyl 4-(2-nitro-4-sulfamoylanilino)piperidine-1-carboxylate (PubChem CID 67227168) has the molecular formula C26H44N6O8S and a molecular weight of 600.74 g/mol. Its IUPAC name is tert-butyl 4-aminopiperidine-1-carboxylate;tert-butyl 4-(2-nitro-4-sulfamoylanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-aminopiperidine-1-carboxylate;tert-butyl 4-(2-nitro-4-sulfamoylanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67227168 |
| Molecular Formula | C26H44N6O8S |
| Molecular Weight | 600.74 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | tert-butyl 4-aminopiperidine-1-carboxylate;tert-butyl 4-(2-nitro-4-sulfamoylanilino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)CC1.CC(C)(C)OC(=O)N1CCC(Nc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H24N4O6S.C10H20N2O2/c1-16(2,3)26-15(21)19-8-6-11(7-9-19)18-13-5-4-12(27(17,24)25)10-14(13)20(22)23;1-10(2,3)14-9(13)12-6-4-8(11)5-7-12/h4-5,10-11,18H,6-9H2,1-3H3,(H2,17,24,25);8H,4-7,11H2,1-3H3 |
| InChIKey | KHVFYUCMSPGUTL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 200.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.74 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|